About 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine
1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine (PubChem CID 62625316) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine |
| PubChem CID | 62625316 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine |
| SMILES | CCNC(CCN1CC(C)OCC1C)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O/c1-7-16-14(15(4,5)6)8-9-17-10-13(3)18-11-12(17)2/h12-14,16H,7-11H2,1-6H3 |
| InChIKey | XMLXZXRAJOWVDT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine?
The IUPAC name of 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine (CID 62625316) is 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine.
What is the SMILES notation for 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine?
The canonical SMILES for 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine is CCNC(CCN1CC(C)OCC1C)C(C)(C)C.
What is the InChIKey of 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine?
The InChIKey is XMLXZXRAJOWVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-7-16-14(15(4,5)6)8-9-17-10-13(3)18-11-12(17)2/h12-14,16H,7-11H2,1-6H3.
What are the key properties of 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine?
1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine has a molecular weight of 256.43 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylmorpholin-4-yl)-N-ethyl-4,4-dimethylpentan-3-amine is sourced from PubChem (CID 62625316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).