About (2Z)-2,4-dimethylhepta-2,6-dienal
(2Z)-2,4-dimethylhepta-2,6-dienal (PubChem CID 6262811) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z)-2,4-dimethylhepta-2,6-dienal.
Molecular Properties
| Compound Name | (2Z)-2,4-dimethylhepta-2,6-dienal |
| PubChem CID | 6262811 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (2Z)-2,4-dimethylhepta-2,6-dienal |
| SMILES | C=CCC(C)/C=C(/C)C=O |
| InChI | InChI=1S/C9H14O/c1-4-5-8(2)6-9(3)7-10/h4,6-8H,1,5H2,2-3H3/b9-6- |
| InChIKey | MIHSPYMZXYONJN-TWGQIWQCSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2,4-dimethylhepta-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2,4-dimethylhepta-2,6-dienal?
The IUPAC name of (2Z)-2,4-dimethylhepta-2,6-dienal (CID 6262811) is (2Z)-2,4-dimethylhepta-2,6-dienal.
What is the SMILES notation for (2Z)-2,4-dimethylhepta-2,6-dienal?
The canonical SMILES for (2Z)-2,4-dimethylhepta-2,6-dienal is C=CCC(C)/C=C(/C)C=O.
What is the InChIKey of (2Z)-2,4-dimethylhepta-2,6-dienal?
The InChIKey is MIHSPYMZXYONJN-TWGQIWQCSA-N. The full InChI is InChI=1S/C9H14O/c1-4-5-8(2)6-9(3)7-10/h4,6-8H,1,5H2,2-3H3/b9-6-.
What are the key properties of (2Z)-2,4-dimethylhepta-2,6-dienal?
(2Z)-2,4-dimethylhepta-2,6-dienal has a molecular weight of 138.21 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2,4-dimethylhepta-2,6-dienal is sourced from PubChem (CID 6262811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).