About 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid
2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid (PubChem CID 62628202) has the molecular formula C7H10N4O3S
and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid |
| PubChem CID | 62628202 |
| Molecular Formula | C7H10N4O3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C7H10N4O3S/c1-4(5(12)13)11(2)7(14)9-6-10-8-3-15-6/h3-4H,1-2H3,(H,12,13)(H,9,10,14) |
| InChIKey | YBNUSGNLFUQWKO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid?
The IUPAC name of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid (CID 62628202) is 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid.
What is the SMILES notation for 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid?
The canonical SMILES for 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid is CC(C(=O)O)N(C)C(=O)Nc1nncs1.
What is the InChIKey of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid?
The InChIKey is YBNUSGNLFUQWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O3S/c1-4(5(12)13)11(2)7(14)9-6-10-8-3-15-6/h3-4H,1-2H3,(H,12,13)(H,9,10,14).
What are the key properties of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid?
2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid has a molecular weight of 230.25 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]propanoic acid is sourced from PubChem (CID 62628202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).