C14H20ClNO — CID 62628773
1-(4-chlorophenyl)-3-[cyclopropylmethyl(methyl)amino]propan-1-ol (PubChem CID 62628773) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[cyclopropylmethyl(methyl)amino]propan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-3-[cyclopropylmethyl(methyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 62628773 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[cyclopropylmethyl(methyl)amino]propan-1-ol |
| SMILES | CN(CCC(O)c1ccc(Cl)cc1)CC1CC1 |
| InChI | InChI=1S/C14H20ClNO/c1-16(10-11-2-3-11)9-8-14(17)12-4-6-13(15)7-5-12/h4-7,11,14,17H,2-3,8-10H2,1H3 |
| InChIKey | QQQKANIMMSVNNB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |