C13H22N6O2 — CID 626291
N,N-dimethyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 626291) has the molecular formula C13H22N6O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is N,N-dimethyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N,N-dimethyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 626291 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N,N-dimethyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H22N6O2/c1-17(2)11-14-12(18-3-7-20-8-4-18)16-13(15-11)19-5-9-21-10-6-19/h3-10H2,1-2H3 |
| InChIKey | KNOLQAZYWBMVSH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |