C14H20FNOS — CID 62629154
1-(3-fluorophenyl)-3-(1,4-thiazepan-4-yl)propan-1-ol (PubChem CID 62629154) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(1,4-thiazepan-4-yl)propan-1-ol.
| Compound Name | 1-(3-fluorophenyl)-3-(1,4-thiazepan-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 62629154 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(1,4-thiazepan-4-yl)propan-1-ol |
| SMILES | OC(CCN1CCCSCC1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNOS/c15-13-4-1-3-12(11-13)14(17)5-7-16-6-2-9-18-10-8-16/h1,3-4,11,14,17H,2,5-10H2 |
| InChIKey | BQJPQUCYCARWDI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |