C16H27ClN2 — CID 62629730
1-(3-chlorophenyl)-N-methyl-N',N'-dipropylpropane-1,3-diamine (PubChem CID 62629730) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-methyl-N',N'-dipropylpropane-1,3-diamine.
| Compound Name | 1-(3-chlorophenyl)-N-methyl-N',N'-dipropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62629730 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(3-chlorophenyl)-N-methyl-N',N'-dipropylpropane-1,3-diamine |
| SMILES | CCCN(CCC)CCC(NC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H27ClN2/c1-4-10-19(11-5-2)12-9-16(18-3)14-7-6-8-15(17)13-14/h6-8,13,16,18H,4-5,9-12H2,1-3H3 |
| InChIKey | TZAPPZCXJCREMG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |