About 1-ethylsulfinylethane
1-ethylsulfinylethane (PubChem CID 6263) has the molecular formula C4H10OS
and a molecular weight of 106.19 g/mol. Its IUPAC name is 1-ethylsulfinylethane.
Molecular Properties
| Compound Name | 1-ethylsulfinylethane |
| PubChem CID | 6263 |
| Molecular Formula | C4H10OS |
| Molecular Weight | 106.19 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 1-ethylsulfinylethane |
| SMILES | CCS(=O)CC |
| InChI | InChI=1S/C4H10OS/c1-3-6(5)4-2/h3-4H2,1-2H3 |
| InChIKey | CCAFPWNGIUBUSD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethylsulfinylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfinylethane?
The IUPAC name of 1-ethylsulfinylethane (CID 6263) is 1-ethylsulfinylethane.
What is the SMILES notation for 1-ethylsulfinylethane?
The canonical SMILES for 1-ethylsulfinylethane is CCS(=O)CC.
What is the InChIKey of 1-ethylsulfinylethane?
The InChIKey is CCAFPWNGIUBUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10OS/c1-3-6(5)4-2/h3-4H2,1-2H3.
What are the key properties of 1-ethylsulfinylethane?
1-ethylsulfinylethane has a molecular weight of 106.19 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfinylethane is sourced from PubChem (CID 6263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).