C16H22FNO2 — CID 62631013
3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-(2-fluorophenyl)propan-1-ol (PubChem CID 62631013) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-(2-fluorophenyl)propan-1-ol.
| Compound Name | 3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-(2-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 62631013 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-(2-fluorophenyl)propan-1-ol |
| SMILES | OC(CCN1CCOC2CCCC21)c1ccccc1F |
| InChI | InChI=1S/C16H22FNO2/c17-13-5-2-1-4-12(13)15(19)8-9-18-10-11-20-16-7-3-6-14(16)18/h1-2,4-5,14-16,19H,3,6-11H2 |
| InChIKey | LSBZLUHGALLFGF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |