C14H20BrN — CID 62632119
N-[(2-bromophenyl)methyl]-1-cyclopentylethanamine (PubChem CID 62632119) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-1-cyclopentylethanamine.
| Compound Name | N-[(2-bromophenyl)methyl]-1-cyclopentylethanamine |
|---|---|
| PubChem CID | 62632119 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-1-cyclopentylethanamine |
| SMILES | CC(NCc1ccccc1Br)C1CCCC1 |
| InChI | InChI=1S/C14H20BrN/c1-11(12-6-2-3-7-12)16-10-13-8-4-5-9-14(13)15/h4-5,8-9,11-12,16H,2-3,6-7,10H2,1H3 |
| InChIKey | RPKNALCIAVPQJE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |