C15H23N — CID 62634053
N-(1-cyclopentylethyl)-3,4-dimethylaniline (PubChem CID 62634053) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-(1-cyclopentylethyl)-3,4-dimethylaniline.
| Compound Name | N-(1-cyclopentylethyl)-3,4-dimethylaniline |
|---|---|
| PubChem CID | 62634053 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-(1-cyclopentylethyl)-3,4-dimethylaniline |
| SMILES | Cc1ccc(NC(C)C2CCCC2)cc1C |
| InChI | InChI=1S/C15H23N/c1-11-8-9-15(10-12(11)2)16-13(3)14-6-4-5-7-14/h8-10,13-14,16H,4-7H2,1-3H3 |
| InChIKey | MTGIFKRGLBJBKG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |