C19H18O3 — CID 626354
4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione (PubChem CID 626354) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione.
| Compound Name | 4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione |
|---|---|
| PubChem CID | 626354 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione |
| SMILES | Cc1coc2c1C(=O)c1ccc3c(c1C2=O)CCCC3(C)C |
| InChI | InChI=1S/C19H18O3/c1-10-9-22-18-14(10)16(20)12-6-7-13-11(15(12)17(18)21)5-4-8-19(13,2)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | QHGPIJMPUOVBOL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|