C14H18Br2O5 — CID 626360
17,18-dibromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene (PubChem CID 626360) has the molecular formula C14H18Br2O5 and a molecular weight of 426.10 g/mol. Its IUPAC name is 17,18-dibromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene.
| Compound Name | 17,18-dibromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene |
|---|---|
| PubChem CID | 626360 |
| Molecular Formula | C14H18Br2O5 |
| Molecular Weight | 426.10 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 17,18-dibromo-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene |
| SMILES | Brc1cc2c(cc1Br)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H18Br2O5/c15-11-9-13-14(10-12(11)16)21-8-6-19-4-2-17-1-3-18-5-7-20-13/h9-10H,1-8H2 |
| InChIKey | JBQPMTPIOPFZOU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.10 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |