C12H28N2 — CID 62636047
N'-ethyl-N-heptan-4-yl-N'-methylethane-1,2-diamine (PubChem CID 62636047) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is N'-ethyl-N-heptan-4-yl-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-heptan-4-yl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62636047 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N'-ethyl-N-heptan-4-yl-N'-methylethane-1,2-diamine |
| SMILES | CCCC(CCC)NCCN(C)CC |
| InChI | InChI=1S/C12H28N2/c1-5-8-12(9-6-2)13-10-11-14(4)7-3/h12-13H,5-11H2,1-4H3 |
| InChIKey | PIOUCCIHKFUPNJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |