C10H21N3O3 — CID 62637183
2-[3-(dimethylamino)propylcarbamoyl-methylamino]propanoic acid (PubChem CID 62637183) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylcarbamoyl-methylamino]propanoic acid.
| Compound Name | 2-[3-(dimethylamino)propylcarbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62637183 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-[3-(dimethylamino)propylcarbamoyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C10H21N3O3/c1-8(9(14)15)13(4)10(16)11-6-5-7-12(2)3/h8H,5-7H2,1-4H3,(H,11,16)(H,14,15) |
| InChIKey | UMVVXZPHGZDJFJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|