C12H16N2O3 — CID 62638983
N-(1,3-benzodioxol-4-ylmethyl)-2-(methylamino)propanamide (PubChem CID 62638983) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-2-(methylamino)propanamide.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 62638983 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C12H16N2O3/c1-8(13-2)12(15)14-6-9-4-3-5-10-11(9)17-7-16-10/h3-5,8,13H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | IUNPUPFJLMSUNR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |