About 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one
6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one (PubChem CID 62640255) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one |
| PubChem CID | 62640255 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one |
| SMILES | CC(C)N(C)CCn1ccc2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C16H26N2O/c1-12(2)17(5)8-9-18-7-6-13-14(18)10-16(3,4)11-15(13)19/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | VRXPHZVHAAYVLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one?
The IUPAC name of 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one (CID 62640255) is 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one.
What is the SMILES notation for 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one?
The canonical SMILES for 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one is CC(C)N(C)CCn1ccc2c1CC(C)(C)CC2=O.
What is the InChIKey of 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one?
The InChIKey is VRXPHZVHAAYVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-12(2)17(5)8-9-18-7-6-13-14(18)10-16(3,4)11-15(13)19/h6-7,12H,8-11H2,1-5H3.
What are the key properties of 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one?
6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one has a molecular weight of 262.40 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dihydroindol-4-one is sourced from PubChem (CID 62640255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).