C14H18ClN3O2S — CID 62640374
2-[5-chloro-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 62640374) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 2-[5-chloro-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-chloro-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62640374 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[5-chloro-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CCN(C)CCn1c(SCC(=O)O)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H18ClN3O2S/c1-3-17(2)6-7-18-12-5-4-10(15)8-11(12)16-14(18)21-9-13(19)20/h4-5,8H,3,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | NWFJKXSDYRFISN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |