C16H26N4 — CID 62640970
2-tert-butyl-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-5-amine (PubChem CID 62640970) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-tert-butyl-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 62640970 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 2-tert-butyl-1-[2-[ethyl(methyl)amino]ethyl]benzimidazol-5-amine |
| SMILES | CCN(C)CCn1c(C(C)(C)C)nc2cc(N)ccc21 |
| InChI | InChI=1S/C16H26N4/c1-6-19(5)9-10-20-14-8-7-12(17)11-13(14)18-15(20)16(2,3)4/h7-8,11H,6,9-10,17H2,1-5H3 |
| InChIKey | DEGRZPWKPVTNET-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|