C17H27FN2 — CID 62644087
N-ethyl-1-(4-fluorophenyl)-3-(3-methylpiperidin-1-yl)propan-1-amine (PubChem CID 62644087) has the molecular formula C17H27FN2 and a molecular weight of 278.42 g/mol. Its IUPAC name is N-ethyl-1-(4-fluorophenyl)-3-(3-methylpiperidin-1-yl)propan-1-amine.
| Compound Name | N-ethyl-1-(4-fluorophenyl)-3-(3-methylpiperidin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 62644087 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | N-ethyl-1-(4-fluorophenyl)-3-(3-methylpiperidin-1-yl)propan-1-amine |
| SMILES | CCNC(CCN1CCCC(C)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H27FN2/c1-3-19-17(15-6-8-16(18)9-7-15)10-12-20-11-4-5-14(2)13-20/h6-9,14,17,19H,3-5,10-13H2,1-2H3 |
| InChIKey | NMXZSAMZALMAJG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |