C11H17ClN2 — CID 62644628
1-(2-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 62644628) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | 1-(2-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62644628 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(2-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCC(N)c1ccccc1Cl |
| InChI | InChI=1S/C11H17ClN2/c1-14(2)8-7-11(13)9-5-3-4-6-10(9)12/h3-6,11H,7-8,13H2,1-2H3 |
| InChIKey | XULLKXZGTORSEB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |