C12H19FN2 — CID 62644803
1-(3-fluorophenyl)-N,N',N'-trimethylpropane-1,3-diamine (PubChem CID 62644803) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N,N',N'-trimethylpropane-1,3-diamine.
| Compound Name | 1-(3-fluorophenyl)-N,N',N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62644803 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-(3-fluorophenyl)-N,N',N'-trimethylpropane-1,3-diamine |
| SMILES | CNC(CCN(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C12H19FN2/c1-14-12(7-8-15(2)3)10-5-4-6-11(13)9-10/h4-6,9,12,14H,7-8H2,1-3H3 |
| InChIKey | KEMRGVFCAYONNW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |