C13H15ClN2OS — CID 62645592
3-(3-chlorophenyl)sulfanyl-N-(2-cyanoethyl)-N-methylpropanamide (PubChem CID 62645592) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfanyl-N-(2-cyanoethyl)-N-methylpropanamide.
| Compound Name | 3-(3-chlorophenyl)sulfanyl-N-(2-cyanoethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 62645592 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(3-chlorophenyl)sulfanyl-N-(2-cyanoethyl)-N-methylpropanamide |
| SMILES | CN(CCC#N)C(=O)CCSc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2OS/c1-16(8-3-7-15)13(17)6-9-18-12-5-2-4-11(14)10-12/h2,4-5,10H,3,6,8-9H2,1H3 |
| InChIKey | CYALKLGQHJMXLW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |