C12H13N3O2S — CID 62646004
3-cyano-N-(1-cyanobutan-2-yl)benzenesulfonamide (PubChem CID 62646004) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-cyano-N-(1-cyanobutan-2-yl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(1-cyanobutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62646004 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-cyano-N-(1-cyanobutan-2-yl)benzenesulfonamide |
| SMILES | CCC(CC#N)NS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-11(6-7-13)15-18(16,17)12-5-3-4-10(8-12)9-14/h3-5,8,11,15H,2,6H2,1H3 |
| InChIKey | AMLSZTLJBCIEIK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |