C14H16ClNS2 — CID 62646460
1-(3-chlorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)propan-2-amine (PubChem CID 62646460) has the molecular formula C14H16ClNS2 and a molecular weight of 297.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 62646460 |
| Molecular Formula | C14H16ClNS2 |
| Molecular Weight | 297.88 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)propan-2-amine |
| SMILES | Cc1ccc(C(Sc2cccc(Cl)c2)C(C)N)s1 |
| InChI | InChI=1S/C14H16ClNS2/c1-9-6-7-13(17-9)14(10(2)16)18-12-5-3-4-11(15)8-12/h3-8,10,14H,16H2,1-2H3 |
| InChIKey | FNHJKZIHICBJDI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.88 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |