About 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine
1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine (PubChem CID 62646774) has the molecular formula C8H11F3N2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine.
Molecular Properties
| Compound Name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine |
| PubChem CID | 62646774 |
| Molecular Formula | C8H11F3N2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H11F3N2S/c1-2-5(12)3-7-13-6(4-14-7)8(9,10)11/h4-5H,2-3,12H2,1H3 |
| InChIKey | PPELIXPJBFELMQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine?
The IUPAC name of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine (CID 62646774) is 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine.
What is the SMILES notation for 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine?
The canonical SMILES for 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine is CCC(N)Cc1nc(C(F)(F)F)cs1.
What is the InChIKey of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine?
The InChIKey is PPELIXPJBFELMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2S/c1-2-5(12)3-7-13-6(4-14-7)8(9,10)11/h4-5H,2-3,12H2,1H3.
What are the key properties of 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine?
1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine has a molecular weight of 224.25 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine is sourced from PubChem (CID 62646774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).