C13H17ClN2OS — CID 62647394
3-(3-chlorophenyl)sulfanyl-2-(cyclopropylamino)-2-methylpropanamide (PubChem CID 62647394) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfanyl-2-(cyclopropylamino)-2-methylpropanamide.
| Compound Name | 3-(3-chlorophenyl)sulfanyl-2-(cyclopropylamino)-2-methylpropanamide |
|---|---|
| PubChem CID | 62647394 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(3-chlorophenyl)sulfanyl-2-(cyclopropylamino)-2-methylpropanamide |
| SMILES | CC(CSc1cccc(Cl)c1)(NC1CC1)C(N)=O |
| InChI | InChI=1S/C13H17ClN2OS/c1-13(12(15)17,16-10-5-6-10)8-18-11-4-2-3-9(14)7-11/h2-4,7,10,16H,5-6,8H2,1H3,(H2,15,17) |
| InChIKey | ARXSLAYJWZXEAR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |