C11H13ClN2S — CID 62647536
3-(3-chlorophenyl)sulfanyl-2-(ethylamino)propanenitrile (PubChem CID 62647536) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfanyl-2-(ethylamino)propanenitrile.
| Compound Name | 3-(3-chlorophenyl)sulfanyl-2-(ethylamino)propanenitrile |
|---|---|
| PubChem CID | 62647536 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3-(3-chlorophenyl)sulfanyl-2-(ethylamino)propanenitrile |
| SMILES | CCNC(C#N)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClN2S/c1-2-14-10(7-13)8-15-11-5-3-4-9(12)6-11/h3-6,10,14H,2,8H2,1H3 |
| InChIKey | PZFRECRVKPRYSI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |