C11H10FN3O2 — CID 62648700
2-amino-3-fluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide (PubChem CID 62648700) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide.
| Compound Name | 2-amino-3-fluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 62648700 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-amino-3-fluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(F)c2N)on1 |
| InChI | InChI=1S/C11H10FN3O2/c1-6-5-9(17-15-6)14-11(16)7-3-2-4-8(12)10(7)13/h2-5H,13H2,1H3,(H,14,16) |
| InChIKey | NSJVYKCITNQATJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|