C17H17F2NO — CID 62648755
N-[(2,4-dimethylphenyl)methyl]-2,3-difluoro-N-methylbenzamide (PubChem CID 62648755) has the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-2,3-difluoro-N-methylbenzamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-2,3-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 62648755 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-2,3-difluoro-N-methylbenzamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2cccc(F)c2F)c(C)c1 |
| InChI | InChI=1S/C17H17F2NO/c1-11-7-8-13(12(2)9-11)10-20(3)17(21)14-5-4-6-15(18)16(14)19/h4-9H,10H2,1-3H3 |
| InChIKey | LMHWEBVVBOBVGT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |