C14H10F3NO — CID 62648850
2,3-difluoro-N-(2-fluoro-4-methylphenyl)benzamide (PubChem CID 62648850) has the molecular formula C14H10F3NO and a molecular weight of 265.23 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-fluoro-4-methylphenyl)benzamide.
| Compound Name | 2,3-difluoro-N-(2-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 62648850 |
| Molecular Formula | C14H10F3NO |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2,3-difluoro-N-(2-fluoro-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C14H10F3NO/c1-8-5-6-12(11(16)7-8)18-14(19)9-3-2-4-10(15)13(9)17/h2-7H,1H3,(H,18,19) |
| InChIKey | LGVQMNQAXDUYDA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |