C11H12N2O2 — CID 62651288
N-(2-cyanoethyl)-2-(3-hydroxyphenyl)acetamide (PubChem CID 62651288) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 62651288 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3-hydroxyphenyl)acetamide |
| SMILES | N#CCCNC(=O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C11H12N2O2/c12-5-2-6-13-11(15)8-9-3-1-4-10(14)7-9/h1,3-4,7,14H,2,6,8H2,(H,13,15) |
| InChIKey | BPLUVDFAMSFDOU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|