About 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine
1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine (PubChem CID 62652293) has the molecular formula C14H15ClN2O2S
and a molecular weight of 310.81 g/mol. Its IUPAC name is 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine.
Molecular Properties
| Compound Name | 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine |
| PubChem CID | 62652293 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1cnc(-c2cc(Cl)c3c(c2)OCO3)s1 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-3-16-8(2)12-6-17-14(20-12)9-4-10(15)13-11(5-9)18-7-19-13/h4-6,8,16H,3,7H2,1-2H3 |
| InChIKey | FJYBAPGXIWZEBA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine?
The IUPAC name of 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine (CID 62652293) is 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine.
What is the SMILES notation for 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine?
The canonical SMILES for 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine is CCNC(C)c1cnc(-c2cc(Cl)c3c(c2)OCO3)s1.
What is the InChIKey of 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine?
The InChIKey is FJYBAPGXIWZEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O2S/c1-3-16-8(2)12-6-17-14(20-12)9-4-10(15)13-11(5-9)18-7-19-13/h4-6,8,16H,3,7H2,1-2H3.
What are the key properties of 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine?
1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine has a molecular weight of 310.81 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]-N-ethylethanamine is sourced from PubChem (CID 62652293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).