About 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone
1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 62652804) has the molecular formula C7H6F3NOS
and a molecular weight of 209.19 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone.
Analyze 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone?
The IUPAC name of 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone (CID 62652804) is 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone.
What is the SMILES notation for 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone?
The canonical SMILES for 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone is CC(=O)c1cnc(CC(F)(F)F)s1.
What is the InChIKey of 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone?
The InChIKey is BOMKKZWRBWNPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NOS/c1-4(12)5-3-11-6(13-5)2-7(8,9)10/h3H,2H2,1H3.
What are the key properties of 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone?
1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone has a molecular weight of 209.19 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]ethanone is sourced from PubChem (CID 62652804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).