About 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine
1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 62653547) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine |
| PubChem CID | 62653547 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CC(C)CCc1ncc(C(C)N)s1 |
| InChI | InChI=1S/C10H18N2S/c1-7(2)4-5-10-12-6-9(13-10)8(3)11/h6-8H,4-5,11H2,1-3H3 |
| InChIKey | STQQOYHEOWHOAQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine?
The IUPAC name of 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine (CID 62653547) is 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine.
What is the SMILES notation for 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine?
The canonical SMILES for 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine is CC(C)CCc1ncc(C(C)N)s1.
What is the InChIKey of 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine?
The InChIKey is STQQOYHEOWHOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-7(2)4-5-10-12-6-9(13-10)8(3)11/h6-8H,4-5,11H2,1-3H3.
What are the key properties of 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine?
1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine has a molecular weight of 198.33 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-methylbutyl)-1,3-thiazol-5-yl]ethanamine is sourced from PubChem (CID 62653547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).