C14H20N2O2S — CID 62654113
2-(4-formylpiperidin-1-yl)-N-methyl-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 62654113) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-(4-formylpiperidin-1-yl)-N-methyl-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-(4-formylpiperidin-1-yl)-N-methyl-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 62654113 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(4-formylpiperidin-1-yl)-N-methyl-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | CN(Cc1ccsc1)C(=O)CN1CCC(C=O)CC1 |
| InChI | InChI=1S/C14H20N2O2S/c1-15(8-13-4-7-19-11-13)14(18)9-16-5-2-12(10-17)3-6-16/h4,7,10-12H,2-3,5-6,8-9H2,1H3 |
| InChIKey | XVEGJTWGUROGEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|