About 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde
1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde (PubChem CID 62655377) has the molecular formula C19H29NO
and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde |
| PubChem CID | 62655377 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CN1CCC(C=O)CC1 |
| InChI | InChI=1S/C19H29NO/c1-14-10-17(19(3,4)5)11-15(2)18(14)12-20-8-6-16(13-21)7-9-20/h10-11,13,16H,6-9,12H2,1-5H3 |
| InChIKey | CAKTZUQDKILUEE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde?
The IUPAC name of 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde (CID 62655377) is 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde.
What is the SMILES notation for 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde?
The canonical SMILES for 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde is Cc1cc(C(C)(C)C)cc(C)c1CN1CCC(C=O)CC1.
What is the InChIKey of 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde?
The InChIKey is CAKTZUQDKILUEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO/c1-14-10-17(19(3,4)5)11-15(2)18(14)12-20-8-6-16(13-21)7-9-20/h10-11,13,16H,6-9,12H2,1-5H3.
What are the key properties of 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde?
1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde has a molecular weight of 287.45 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]piperidine-4-carbaldehyde is sourced from PubChem (CID 62655377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).