C14H24N2O3 — CID 62656806
1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]piperidine-4-carbaldehyde (PubChem CID 62656806) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 62656806 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]piperidine-4-carbaldehyde |
| SMILES | CC1CN(C(=O)CN2CCC(C=O)CC2)CC(C)O1 |
| InChI | InChI=1S/C14H24N2O3/c1-11-7-16(8-12(2)19-11)14(18)9-15-5-3-13(10-17)4-6-15/h10-13H,3-9H2,1-2H3 |
| InChIKey | CQDYXLZJRUGLQI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|