C16H16N4O2 — CID 626571
3,5-bis(phenoxymethyl)-1,2,4-triazol-4-amine (PubChem CID 626571) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3,5-bis(phenoxymethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis(phenoxymethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 626571 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3,5-bis(phenoxymethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(COc2ccccc2)nnc1COc1ccccc1 |
| InChI | InChI=1S/C16H16N4O2/c17-20-15(11-21-13-7-3-1-4-8-13)18-19-16(20)12-22-14-9-5-2-6-10-14/h1-10H,11-12,17H2 |
| InChIKey | QCCXSPLAUHVWMJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |