C17H27N3O — CID 62657161
N-ethyl-3-methyl-4-[(1-methylpiperidin-3-yl)methylamino]benzamide (PubChem CID 62657161) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-ethyl-3-methyl-4-[(1-methylpiperidin-3-yl)methylamino]benzamide.
| Compound Name | N-ethyl-3-methyl-4-[(1-methylpiperidin-3-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 62657161 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-ethyl-3-methyl-4-[(1-methylpiperidin-3-yl)methylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(NCC2CCCN(C)C2)c(C)c1 |
| InChI | InChI=1S/C17H27N3O/c1-4-18-17(21)15-7-8-16(13(2)10-15)19-11-14-6-5-9-20(3)12-14/h7-8,10,14,19H,4-6,9,11-12H2,1-3H3,(H,18,21) |
| InChIKey | ISKZKLKHYORHDA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |