C18H28N2S — CID 62658840
4-cyclopentylsulfanyl-N-[(1-methylpiperidin-4-yl)methyl]aniline (PubChem CID 62658840) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 4-cyclopentylsulfanyl-N-[(1-methylpiperidin-4-yl)methyl]aniline.
| Compound Name | 4-cyclopentylsulfanyl-N-[(1-methylpiperidin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62658840 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 4-cyclopentylsulfanyl-N-[(1-methylpiperidin-4-yl)methyl]aniline |
| SMILES | CN1CCC(CNc2ccc(SC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C18H28N2S/c1-20-12-10-15(11-13-20)14-19-16-6-8-18(9-7-16)21-17-4-2-3-5-17/h6-9,15,17,19H,2-5,10-14H2,1H3 |
| InChIKey | GLGYGUUHGHGSRJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |