C21H22N2O3S — CID 6265949
(E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 6265949) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6265949 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NC3=NCCCS3)cc2)cc1OC |
| InChI | InChI=1S/C21H22N2O3S/c1-25-19-11-5-15(14-20(19)26-2)4-10-18(24)16-6-8-17(9-7-16)23-21-22-12-3-13-27-21/h4-11,14H,3,12-13H2,1-2H3,(H,22,23)/b10-4+ |
| InChIKey | LPEUDECWYKGQSK-ONNFQVAWSA-N |
| XLogP | 4.50 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|