About N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine
N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine (PubChem CID 62659503) has the molecular formula C7H11N7
and a molecular weight of 193.21 g/mol. Its IUPAC name is N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine |
| PubChem CID | 62659503 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine |
| SMILES | CNCCNc1cncc2nnnn12 |
| InChI | InChI=1S/C7H11N7/c1-8-2-3-10-6-4-9-5-7-11-12-13-14(6)7/h4-5,8,10H,2-3H2,1H3 |
| InChIKey | DZTFQDONGHCXJM-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
The IUPAC name of N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine (CID 62659503) is N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine.
What is the SMILES notation for N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
The canonical SMILES for N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine is CNCCNc1cncc2nnnn12.
What is the InChIKey of N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
The InChIKey is DZTFQDONGHCXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N7/c1-8-2-3-10-6-4-9-5-7-11-12-13-14(6)7/h4-5,8,10H,2-3H2,1H3.
What are the key properties of N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine has a molecular weight of 193.21 g/mol, XLogP of -0.85, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 62659503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).