C13H20N2O2 — CID 62659653
N-[2-(methylamino)ethyl]-3-(3-methylphenoxy)propanamide (PubChem CID 62659653) has the molecular formula C13H20N2O2 and a molecular weight of 236.32 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-(3-methylphenoxy)propanamide.
| Compound Name | N-[2-(methylamino)ethyl]-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 62659653 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-(3-methylphenoxy)propanamide |
| SMILES | CNCCNC(=O)CCOc1cccc(C)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-11-4-3-5-12(10-11)17-9-6-13(16)15-8-7-14-2/h3-5,10,14H,6-9H2,1-2H3,(H,15,16) |
| InChIKey | ZMIXHNLBSDBMQQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|