C13H10Cl2FN3O — CID 62660094
N-(3,4-dichlorophenyl)-3-fluoro-2-hydrazinylbenzamide (PubChem CID 62660094) has the molecular formula C13H10Cl2FN3O and a molecular weight of 314.15 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-fluoro-2-hydrazinylbenzamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-fluoro-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 62660094 |
| Molecular Formula | C13H10Cl2FN3O |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-fluoro-2-hydrazinylbenzamide |
| SMILES | NNc1c(F)cccc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2FN3O/c14-9-5-4-7(6-10(9)15)18-13(20)8-2-1-3-11(16)12(8)19-17/h1-6,19H,17H2,(H,18,20) |
| InChIKey | VGQPKIPDBASOOY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|