C14H21FN4O — CID 62660994
(3-fluoro-2-hydrazinylphenyl)-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 62660994) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is (3-fluoro-2-hydrazinylphenyl)-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | (3-fluoro-2-hydrazinylphenyl)-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 62660994 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3-fluoro-2-hydrazinylphenyl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)c2cccc(F)c2NN)CC1 |
| InChI | InChI=1S/C14H21FN4O/c1-10(2)18-6-8-19(9-7-18)14(20)11-4-3-5-12(15)13(11)17-16/h3-5,10,17H,6-9,16H2,1-2H3 |
| InChIKey | ARVFKZPNZMZTCC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|