About 1,3,5-triphenylpyrazole
1,3,5-triphenylpyrazole (PubChem CID 626614) has the molecular formula C21H16N2
and a molecular weight of 296.37 g/mol. Its IUPAC name is 1,3,5-triphenylpyrazole.
Molecular Properties
| Compound Name | 1,3,5-triphenylpyrazole |
| PubChem CID | 626614 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1,3,5-triphenylpyrazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H16N2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23(22-20)19-14-8-3-9-15-19/h1-16H |
| InChIKey | YQDSXDPQYUXRDP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3,5-triphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-triphenylpyrazole?
The IUPAC name of 1,3,5-triphenylpyrazole (CID 626614) is 1,3,5-triphenylpyrazole.
What is the SMILES notation for 1,3,5-triphenylpyrazole?
The canonical SMILES for 1,3,5-triphenylpyrazole is c1ccc(-c2cc(-c3ccccc3)n(-c3ccccc3)n2)cc1.
What is the InChIKey of 1,3,5-triphenylpyrazole?
The InChIKey is YQDSXDPQYUXRDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23(22-20)19-14-8-3-9-15-19/h1-16H.
What are the key properties of 1,3,5-triphenylpyrazole?
1,3,5-triphenylpyrazole has a molecular weight of 296.37 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-triphenylpyrazole is sourced from PubChem (CID 626614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).