C11H7ClF2OS — CID 62661789
(5-chlorothiophen-2-yl)-(2,3-difluorophenyl)methanol (PubChem CID 62661789) has the molecular formula C11H7ClF2OS and a molecular weight of 260.69 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(2,3-difluorophenyl)methanol.
| Compound Name | (5-chlorothiophen-2-yl)-(2,3-difluorophenyl)methanol |
|---|---|
| PubChem CID | 62661789 |
| Molecular Formula | C11H7ClF2OS |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(2,3-difluorophenyl)methanol |
| SMILES | OC(c1ccc(Cl)s1)c1cccc(F)c1F |
| InChI | InChI=1S/C11H7ClF2OS/c12-9-5-4-8(16-9)11(15)6-2-1-3-7(13)10(6)14/h1-5,11,15H |
| InChIKey | CGOVHQKHRHXSPC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |