C11H17IN2O2S — CID 62663707
4-iodo-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide (PubChem CID 62663707) has the molecular formula C11H17IN2O2S and a molecular weight of 368.24 g/mol. Its IUPAC name is 4-iodo-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-iodo-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62663707 |
| Molecular Formula | C11H17IN2O2S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 4-iodo-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide |
| SMILES | CC(C)NCCNS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H17IN2O2S/c1-9(2)13-7-8-14-17(15,16)11-5-3-10(12)4-6-11/h3-6,9,13-14H,7-8H2,1-2H3 |
| InChIKey | RISDMPUUHMZWMH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|