C12H21N3O2S — CID 62664041
[2-(ethylamino)ethylsulfamoyl-methylamino]methylbenzene (PubChem CID 62664041) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is [2-(ethylamino)ethylsulfamoyl-methylamino]methylbenzene.
| Compound Name | [2-(ethylamino)ethylsulfamoyl-methylamino]methylbenzene |
|---|---|
| PubChem CID | 62664041 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [2-(ethylamino)ethylsulfamoyl-methylamino]methylbenzene |
| SMILES | CCNCCNS(=O)(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C12H21N3O2S/c1-3-13-9-10-14-18(16,17)15(2)11-12-7-5-4-6-8-12/h4-8,13-14H,3,9-11H2,1-2H3 |
| InChIKey | QOQPEPPCBNOBJA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|